C17H21N3O2 — CID 86777560
1-[[4-(2-methoxyphenoxy)phenyl]methyl]-2,3-dimethylguanidine (PubChem CID 86777560) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[[4-(2-methoxyphenoxy)phenyl]methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[[4-(2-methoxyphenoxy)phenyl]methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 86777560 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[[4-(2-methoxyphenoxy)phenyl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ccc(Oc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-18-17(19-2)20-12-13-8-10-14(11-9-13)22-16-7-5-4-6-15(16)21-3/h4-11H,12H2,1-3H3,(H2,18,19,20) |
| InChIKey | YKVGVYUDBAQSFL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|