C17H22IN3O — CID 111107616
1,2-dimethyl-3-[[2-(4-methylphenoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111107616) has the molecular formula C17H22IN3O and a molecular weight of 411.29 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[2-(4-methylphenoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[2-(4-methylphenoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111107616 |
| Molecular Formula | C17H22IN3O |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 1,2-dimethyl-3-[[2-(4-methylphenoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccccc1Oc1ccc(C)cc1.I |
| InChI | InChI=1S/C17H21N3O.HI/c1-13-8-10-15(11-9-13)21-16-7-5-4-6-14(16)12-20-17(18-2)19-3;/h4-11H,12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | QOZPLJNEMSGGIM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|