C15H18N2O4 — CID 70154494
2-[[(E)-2-oxo-4-phenylbut-3-enoyl]amino]ethyl N-ethylcarbamate (PubChem CID 70154494) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[[(E)-2-oxo-4-phenylbut-3-enoyl]amino]ethyl N-ethylcarbamate.
| Compound Name | 2-[[(E)-2-oxo-4-phenylbut-3-enoyl]amino]ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 70154494 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[[(E)-2-oxo-4-phenylbut-3-enoyl]amino]ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCNC(=O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18N2O4/c1-2-16-15(20)21-11-10-17-14(19)13(18)9-8-12-6-4-3-5-7-12/h3-9H,2,10-11H2,1H3,(H,16,20)(H,17,19)/b9-8+ |
| InChIKey | FIOGNKJGFTWSMF-CMDGGOBGSA-N |
| XLogP | 1.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|