C39H37N7O3 — CID 70155318
[2-[1-(3-aminopropyl)-5-(dibenzylamino)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate (PubChem CID 70155318) has the molecular formula C39H37N7O3 and a molecular weight of 651.77 g/mol. Its IUPAC name is [2-[1-(3-aminopropyl)-5-(dibenzylamino)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate.
| Compound Name | [2-[1-(3-aminopropyl)-5-(dibenzylamino)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate |
|---|---|
| PubChem CID | 70155318 |
| Molecular Formula | C39H37N7O3 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | [2-[1-(3-aminopropyl)-5-(dibenzylamino)indol-3-yl]-7,8-dimethyl-3-oxopyrazino[2,3-g]quinoxalin-4-yl] acetate |
| SMILES | CC(=O)On1c(=O)c(-c2cn(CCCN)c3ccc(N(Cc4ccccc4)Cc4ccccc4)cc23)nc2cc3nc(C)c(C)nc3cc21 |
| InChI | InChI=1S/C39H37N7O3/c1-25-26(2)42-34-21-37-35(20-33(34)41-25)43-38(39(48)46(37)49-27(3)47)32-24-44(18-10-17-40)36-16-15-30(19-31(32)36)45(22-28-11-6-4-7-12-28)23-29-13-8-5-9-14-29/h4-9,11-16,19-21,24H,10,17-18,22-23,40H2,1-3H3 |
| InChIKey | OSRJKHSUDPXCTI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|