C27H19N3O6 — CID 70155895
1-[2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(3-cyanophenyl)urea (PubChem CID 70155895) has the molecular formula C27H19N3O6 and a molecular weight of 481.46 g/mol. Its IUPAC name is 1-[2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(3-cyanophenyl)urea.
| Compound Name | 1-[2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(3-cyanophenyl)urea |
|---|---|
| PubChem CID | 70155895 |
| Molecular Formula | C27H19N3O6 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-[2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(3-cyanophenyl)urea |
| SMILES | N#Cc1cccc(NC(=O)Nc2ccc3oc(C4=COC(Cc5ccccc5)O4)c(O)c(=O)c3c2)c1 |
| InChI | InChI=1S/C27H19N3O6/c28-14-17-7-4-8-18(11-17)29-27(33)30-19-9-10-21-20(13-19)24(31)25(32)26(36-21)22-15-34-23(35-22)12-16-5-2-1-3-6-16/h1-11,13,15,23,32H,12H2,(H2,29,30,33) |
| InChIKey | KRGXGXJPUCKKRM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |