C20H16O5 — CID 70157356
2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-6-methylchromen-4-one (PubChem CID 70157356) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-6-methylchromen-4-one.
| Compound Name | 2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-6-methylchromen-4-one |
|---|---|
| PubChem CID | 70157356 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-(2-benzyl-1,3-dioxol-4-yl)-3-hydroxy-6-methylchromen-4-one |
| SMILES | Cc1ccc2oc(C3=COC(Cc4ccccc4)O3)c(O)c(=O)c2c1 |
| InChI | InChI=1S/C20H16O5/c1-12-7-8-15-14(9-12)18(21)19(22)20(25-15)16-11-23-17(24-16)10-13-5-3-2-4-6-13/h2-9,11,17,22H,10H2,1H3 |
| InChIKey | ANXJWKMGBUYBMZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |