C21H18N2O4 — CID 66845540
N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide (PubChem CID 66845540) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide.
| Compound Name | N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide |
|---|---|
| PubChem CID | 66845540 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide |
| SMILES | C/C(N)=N\c1ccc2oc(C3=COC(Cc4ccccc4)O3)cc(=O)c2c1 |
| InChI | InChI=1S/C21H18N2O4/c1-13(22)23-15-7-8-18-16(10-15)17(24)11-19(26-18)20-12-25-21(27-20)9-14-5-3-2-4-6-14/h2-8,10-12,21H,9H2,1H3,(H2,22,23) |
| InChIKey | OECLXEMLFIYKKG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|