C28H23NO6 — CID 66845110
N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxo-3-phenylmethoxychromen-6-yl]acetamide (PubChem CID 66845110) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxo-3-phenylmethoxychromen-6-yl]acetamide.
| Compound Name | N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxo-3-phenylmethoxychromen-6-yl]acetamide |
|---|---|
| PubChem CID | 66845110 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxo-3-phenylmethoxychromen-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2oc(C3=COC(Cc4ccccc4)O3)c(OCc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C28H23NO6/c1-18(30)29-21-12-13-23-22(15-21)26(31)28(33-16-20-10-6-3-7-11-20)27(35-23)24-17-32-25(34-24)14-19-8-4-2-5-9-19/h2-13,15,17,25H,14,16H2,1H3,(H,29,30) |
| InChIKey | OLVVGMDNYJBJCP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |