C31H25NO6 — CID 69321477
N-[2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxy-4-oxochromen-6-yl]acetamide (PubChem CID 69321477) has the molecular formula C31H25NO6 and a molecular weight of 507.54 g/mol. Its IUPAC name is N-[2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxy-4-oxochromen-6-yl]acetamide.
| Compound Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxy-4-oxochromen-6-yl]acetamide |
|---|---|
| PubChem CID | 69321477 |
| Molecular Formula | C31H25NO6 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxy-4-oxochromen-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2oc(-c3ccc(OCc4ccccc4)c(OCc4ccccc4)c3)c(O)c(=O)c2c1 |
| InChI | InChI=1S/C31H25NO6/c1-20(33)32-24-13-15-26-25(17-24)29(34)30(35)31(38-26)23-12-14-27(36-18-21-8-4-2-5-9-21)28(16-23)37-19-22-10-6-3-7-11-22/h2-17,35H,18-19H2,1H3,(H,32,33) |
| InChIKey | FGRQAUBOSATDFW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |