C31H25NO5 — CID 162435988
N-[(2Z)-2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-3-oxo-1-benzofuran-5-yl]acetamide (PubChem CID 162435988) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-[(2Z)-2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-3-oxo-1-benzofuran-5-yl]acetamide.
| Compound Name | N-[(2Z)-2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-3-oxo-1-benzofuran-5-yl]acetamide |
|---|---|
| PubChem CID | 162435988 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[(2Z)-2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-3-oxo-1-benzofuran-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)/C(=C/c1ccc(OCc3ccccc3)c(OCc3ccccc3)c1)O2 |
| InChI | InChI=1S/C31H25NO5/c1-21(33)32-25-13-15-27-26(18-25)31(34)30(37-27)17-24-12-14-28(35-19-22-8-4-2-5-9-22)29(16-24)36-20-23-10-6-3-7-11-23/h2-18H,19-20H2,1H3,(H,32,33)/b30-17- |
| InChIKey | BSOAHRPSGPGDFF-LQNQUEJISA-N |
| XLogP | 6.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|