C20H16O5 — CID 138756499
[2-methoxy-4-[(Z)-(3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 2-methylprop-2-enoate (PubChem CID 138756499) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-methoxy-4-[(Z)-(3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138756499 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [2-methoxy-4-[(Z)-(3-oxo-1-benzofuran-2-ylidene)methyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(/C=C2\Oc3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C20H16O5/c1-12(2)20(22)25-16-9-8-13(10-17(16)23-3)11-18-19(21)14-6-4-5-7-15(14)24-18/h4-11H,1H2,2-3H3/b18-11- |
| InChIKey | NRESKVQNZORGDW-WQRHYEAKSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|