C29H36N8O2 — CID 70157072
1-(4-methylpiperazin-1-yl)-3-[4-oxo-3-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-8bH-indeno[1,2-c]pyrazol-5-yl]urea (PubChem CID 70157072) has the molecular formula C29H36N8O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-[4-oxo-3-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-8bH-indeno[1,2-c]pyrazol-5-yl]urea.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-[4-oxo-3-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-8bH-indeno[1,2-c]pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 70157072 |
| Molecular Formula | C29H36N8O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-[4-oxo-3-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-8bH-indeno[1,2-c]pyrazol-5-yl]urea |
| SMILES | CC(C)N1CCN(c2ccc(C3=C4C(=O)c5c(NC(=O)NN6CCN(C)CC6)cccc5C4N=N3)cc2)CC1 |
| InChI | InChI=1S/C29H36N8O2/c1-19(2)35-13-15-36(16-14-35)21-9-7-20(8-10-21)26-25-27(32-31-26)22-5-4-6-23(24(22)28(25)38)30-29(39)33-37-17-11-34(3)12-18-37/h4-10,19,27H,11-18H2,1-3H3,(H2,30,33,39) |
| InChIKey | QISQQLLJMKWFMV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|