C22H22N4O3 — CID 70157831
4-[(E)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 70157831) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[(E)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[(E)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70157831 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[(E)-[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1C1=N/C(=C/N2CCN(C(=O)Nc3ccccc3)CC2)C(=O)O1 |
| InChI | InChI=1S/C22H22N4O3/c1-16-7-5-6-10-18(16)20-24-19(21(27)29-20)15-25-11-13-26(14-12-25)22(28)23-17-8-3-2-4-9-17/h2-10,15H,11-14H2,1H3,(H,23,28)/b19-15+ |
| InChIKey | IUYANXPUZYUSGS-XDJHFCHBSA-N |
| XLogP | 2.99 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|