C20H20IN3O3 — CID 70159191
4-(4-cyanofuran-2-yl)oxy-N-[(2S,3R)-2-iodo-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide (PubChem CID 70159191) has the molecular formula C20H20IN3O3 and a molecular weight of 477.30 g/mol. Its IUPAC name is 4-(4-cyanofuran-2-yl)oxy-N-[(2S,3R)-2-iodo-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide.
| Compound Name | 4-(4-cyanofuran-2-yl)oxy-N-[(2S,3R)-2-iodo-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 70159191 |
| Molecular Formula | C20H20IN3O3 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 4-(4-cyanofuran-2-yl)oxy-N-[(2S,3R)-2-iodo-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]benzamide |
| SMILES | C[C@]1(I)[C@H](NC(=O)c2ccc(Oc3cc(C#N)co3)cc2)C2CCN1CC2 |
| InChI | InChI=1S/C20H20IN3O3/c1-20(21)18(14-6-8-24(20)9-7-14)23-19(25)15-2-4-16(5-3-15)27-17-10-13(11-22)12-26-17/h2-5,10,12,14,18H,6-9H2,1H3,(H,23,25)/t18-,20-/m1/s1 |
| InChIKey | ITCKXBKIOARKAM-UYAOXDASSA-N |
| XLogP | 3.92 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|