C18H25N3O — CID 70159942
2-(1H-indol-3-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]propanamide (PubChem CID 70159942) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]propanamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 70159942 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]propanamide |
| SMILES | CC(C(=O)NCCC1CCCN1C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H25N3O/c1-13(16-12-20-17-8-4-3-7-15(16)17)18(22)19-10-9-14-6-5-11-21(14)2/h3-4,7-8,12-14,20H,5-6,9-11H2,1-2H3,(H,19,22) |
| InChIKey | DNCHRYNGHAZTNJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |