C14H19N3O5 — CID 7016072
(2S)-2-[[(2S)-2-[(2-azaniumylacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoate (PubChem CID 7016072) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-azaniumylacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoate.
| Compound Name | (2S)-2-[[(2S)-2-[(2-azaniumylacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 7016072 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-azaniumylacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C14H19N3O5/c1-8(14(21)22)16-13(20)11(17-12(19)7-15)6-9-2-4-10(18)5-3-9/h2-5,8,11,18H,6-7,15H2,1H3,(H,16,20)(H,17,19)(H,21,22)/t8-,11-/m0/s1 |
| InChIKey | UIQGJYUEQDOODF-KWQFWETISA-N |
| XLogP | -3.08 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |