C26H36N2O3 — CID 70163514
tert-butyl N-[3-amino-6-methyl-1-(4-phenylmethoxyphenyl)hept-5-en-3-yl]carbamate (PubChem CID 70163514) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl N-[3-amino-6-methyl-1-(4-phenylmethoxyphenyl)hept-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-amino-6-methyl-1-(4-phenylmethoxyphenyl)hept-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 70163514 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | tert-butyl N-[3-amino-6-methyl-1-(4-phenylmethoxyphenyl)hept-5-en-3-yl]carbamate |
| SMILES | CC(C)=CCC(N)(CCc1ccc(OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36N2O3/c1-20(2)15-17-26(27,28-24(29)31-25(3,4)5)18-16-21-11-13-23(14-12-21)30-19-22-9-7-6-8-10-22/h6-15H,16-19,27H2,1-5H3,(H,28,29) |
| InChIKey | YXWYYZJBMJCMMO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|