C17H24Cl2N2O — CID 70163920
1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride (PubChem CID 70163920) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride.
| Compound Name | 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 70163920 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride |
| SMILES | CCCCC(O)c1ccc(-c2cc(N)ccc2N)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22N2O.2ClH/c1-2-3-4-17(20)13-7-5-12(6-8-13)15-11-14(18)9-10-16(15)19;;/h5-11,17,20H,2-4,18-19H2,1H3;2*1H |
| InChIKey | IBCAQDAEOLEFLO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|