About 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride
1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride (PubChem CID 70163920) has the molecular formula C17H24Cl2N2O
and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride |
| PubChem CID | 70163920 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride |
| SMILES | CCCCC(O)c1ccc(-c2cc(N)ccc2N)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22N2O.2ClH/c1-2-3-4-17(20)13-7-5-12(6-8-13)15-11-14(18)9-10-16(15)19;;/h5-11,17,20H,2-4,18-19H2,1H3;2*1H |
| InChIKey | IBCAQDAEOLEFLO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride?
The IUPAC name of 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride (CID 70163920) is 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride.
What is the SMILES notation for 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride?
The canonical SMILES for 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride is CCCCC(O)c1ccc(-c2cc(N)ccc2N)cc1.Cl.Cl.
What is the InChIKey of 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride?
The InChIKey is IBCAQDAEOLEFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O.2ClH/c1-2-3-4-17(20)13-7-5-12(6-8-13)15-11-14(18)9-10-16(15)19;;/h5-11,17,20H,2-4,18-19H2,1H3;2*1H.
What are the key properties of 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride?
1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride has a molecular weight of 343.30 g/mol, XLogP of 4.59, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,5-diaminophenyl)phenyl]pentan-1-ol;dihydrochloride is sourced from PubChem (CID 70163920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).