C16H22Cl2N2 — CID 18371792
2-(4-butylphenyl)benzene-1,4-diamine;dihydrochloride (PubChem CID 18371792) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-(4-butylphenyl)benzene-1,4-diamine;dihydrochloride.
| Compound Name | 2-(4-butylphenyl)benzene-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18371792 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(4-butylphenyl)benzene-1,4-diamine;dihydrochloride |
| SMILES | CCCCc1ccc(-c2cc(N)ccc2N)cc1.Cl.Cl |
| InChI | InChI=1S/C16H20N2.2ClH/c1-2-3-4-12-5-7-13(8-6-12)15-11-14(17)9-10-16(15)18;;/h5-11H,2-4,17-18H2,1H3;2*1H |
| InChIKey | QIULBDNDRZCTPC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|