C38H41N3O6 — CID 70166280
4-[4-[(2S)-2-[benzyl-[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-hydroxypropyl]phenoxy]-N-(2-methoxyethyl)quinoline-7-carboxamide (PubChem CID 70166280) has the molecular formula C38H41N3O6 and a molecular weight of 635.76 g/mol. Its IUPAC name is 4-[4-[(2S)-2-[benzyl-[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-hydroxypropyl]phenoxy]-N-(2-methoxyethyl)quinoline-7-carboxamide.
| Compound Name | 4-[4-[(2S)-2-[benzyl-[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-hydroxypropyl]phenoxy]-N-(2-methoxyethyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 70166280 |
| Molecular Formula | C38H41N3O6 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 4-[4-[(2S)-2-[benzyl-[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-hydroxypropyl]phenoxy]-N-(2-methoxyethyl)quinoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(Oc3ccc(C[C@@H](CO)N(Cc4ccccc4)C[C@H](O)COc4ccccc4)cc3)ccnc2c1 |
| InChI | InChI=1S/C38H41N3O6/c1-45-21-20-40-38(44)30-14-17-35-36(23-30)39-19-18-37(35)47-34-15-12-28(13-16-34)22-31(26-42)41(24-29-8-4-2-5-9-29)25-32(43)27-46-33-10-6-3-7-11-33/h2-19,23,31-32,42-43H,20-22,24-27H2,1H3,(H,40,44)/t31-,32-/m0/s1 |
| InChIKey | AZTABGUYFLBTKI-ACHIHNKUSA-N |
| XLogP | 5.25 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|