About ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate
ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate (PubChem CID 70167998) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate.
Analyze ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate?
The IUPAC name of ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate (CID 70167998) is ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate.
What is the SMILES notation for ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate?
The canonical SMILES for ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate is CCOC(=O)CCCC(=O)C1=C(C)CCCC1(C)C.
What is the InChIKey of ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate?
The InChIKey is URYUMEZHPSGTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3/c1-5-19-14(18)10-6-9-13(17)15-12(2)8-7-11-16(15,3)4/h5-11H2,1-4H3.
What are the key properties of ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate?
ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate has a molecular weight of 266.38 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxo-5-(2,6,6-trimethylcyclohexen-1-yl)pentanoate is sourced from PubChem (CID 70167998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).