C29H35F2N7O6 — CID 70171386
methyl (4S)-4-(3,4-difluorophenyl)-3-[2-[[2-[2-(2-formylhydrazinyl)phenyl]piperidin-4-yl]amino]ethylcarbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 70171386) has the molecular formula C29H35F2N7O6 and a molecular weight of 615.64 g/mol. Its IUPAC name is methyl (4S)-4-(3,4-difluorophenyl)-3-[2-[[2-[2-(2-formylhydrazinyl)phenyl]piperidin-4-yl]amino]ethylcarbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-(3,4-difluorophenyl)-3-[2-[[2-[2-(2-formylhydrazinyl)phenyl]piperidin-4-yl]amino]ethylcarbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 70171386 |
| Molecular Formula | C29H35F2N7O6 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | methyl (4S)-4-(3,4-difluorophenyl)-3-[2-[[2-[2-(2-formylhydrazinyl)phenyl]piperidin-4-yl]amino]ethylcarbamoyl]-6-(methoxymethyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COCC1=C(C(=O)OC)[C@H](c2ccc(F)c(F)c2)N(C(=O)NCCNC2CCNC(c3ccccc3NNC=O)C2)C(=O)N1 |
| InChI | InChI=1S/C29H35F2N7O6/c1-43-15-24-25(27(40)44-2)26(17-7-8-20(30)21(31)13-17)38(29(42)36-24)28(41)34-12-11-32-18-9-10-33-23(14-18)19-5-3-4-6-22(19)37-35-16-39/h3-8,13,16,18,23,26,32-33,37H,9-12,14-15H2,1-2H3,(H,34,41)(H,35,39)(H,36,42)/t18?,23?,26-/m0/s1 |
| InChIKey | WPWQKRUOBHBZBP-RFWNFUFJSA-N |
| XLogP | 1.97 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|