C28H28ClFN2O3 — CID 70172848
(3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 70172848) has the molecular formula C28H28ClFN2O3 and a molecular weight of 494.99 g/mol. Its IUPAC name is (3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70172848 |
| Molecular Formula | C28H28ClFN2O3 |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CC#Cc4ccccc4Cl)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C28H28ClFN2O3/c1-35-21-9-11-27-23(17-21)22(12-14-31-27)26(30)10-8-19-13-16-32(18-24(19)28(33)34)15-4-6-20-5-2-3-7-25(20)29/h2-3,5,7,9,11-12,14,17,19,24,26H,8,10,13,15-16,18H2,1H3,(H,33,34)/t19-,24+,26?/m1/s1 |
| InChIKey | XMKCVDSNCVQZIR-VONFDHPCSA-N |
| XLogP | 5.76 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|