C27H28FN3O3 — CID 70172746
(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidine-3-carboxylic acid (PubChem CID 70172746) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70172746 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CC#Cc4cccnc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H28FN3O3/c1-34-21-7-9-26-23(16-21)22(10-13-30-26)25(28)8-6-20-11-15-31(18-24(20)27(32)33)14-3-5-19-4-2-12-29-17-19/h2,4,7,9-10,12-13,16-17,20,24-25H,6,8,11,14-15,18H2,1H3,(H,32,33)/t20-,24+,25?/m1/s1 |
| InChIKey | VBTCVICILSMKJC-NNTPGIFBSA-N |
| XLogP | 4.50 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|