C28H30FN3O3 — CID 70175344
2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid (PubChem CID 70175344) has the molecular formula C28H30FN3O3 and a molecular weight of 475.56 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175344 |
| Molecular Formula | C28H30FN3O3 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CC#Cc4cccnc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H30FN3O3/c1-35-23-7-9-27-25(17-23)24(10-13-31-27)26(29)8-6-21-11-15-32(19-22(21)16-28(33)34)14-3-5-20-4-2-12-30-18-20/h2,4,7,9-10,12-13,17-18,21-22,26H,6,8,11,14-16,19H2,1H3,(H,33,34)/t21-,22+,26?/m1/s1 |
| InChIKey | UJPPGUIHJUIEJH-SGNGHUOJSA-N |
| XLogP | 4.89 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|