C27H29FN4O3 — CID 70172820
2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-5-ylprop-2-ynyl)piperidin-3-yl]acetic acid (PubChem CID 70172820) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-5-ylprop-2-ynyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-5-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70172820 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-5-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CC#Cc4cncnc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H29FN4O3/c1-35-22-5-7-26-24(14-22)23(8-10-31-26)25(28)6-4-20-9-12-32(17-21(20)13-27(33)34)11-2-3-19-15-29-18-30-16-19/h5,7-8,10,14-16,18,20-21,25H,4,6,9,11-13,17H2,1H3,(H,33,34)/t20-,21+,25?/m1/s1 |
| InChIKey | PHAYITJHYGZLIR-GJAAFAAWSA-N |
| XLogP | 4.29 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|