C29H28F4N2O3 — CID 70174979
2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid (PubChem CID 70174979) has the molecular formula C29H28F4N2O3 and a molecular weight of 528.55 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70174979 |
| Molecular Formula | C29H28F4N2O3 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CC#Cc4cc(F)cc(F)c4F)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C29H28F4N2O3/c1-38-22-5-7-27-24(16-22)23(8-10-34-27)25(31)6-4-18-9-12-35(17-20(18)14-28(36)37)11-2-3-19-13-21(30)15-26(32)29(19)33/h5,7-8,10,13,15-16,18,20,25H,4,6,9,11-12,14,17H2,1H3,(H,36,37)/t18-,20+,25+/m1/s1 |
| InChIKey | PYGJSEAKDINOIJ-AOUJKTHWSA-N |
| XLogP | 5.92 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|