C13H13N2O3- — CID 7017316
1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 7017316) has the molecular formula C13H13N2O3- and a molecular weight of 245.26 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | 1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7017316 |
| Molecular Formula | C13H13N2O3- |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | Cc1cc(C)cc(OCn2ccc(C(=O)[O-])n2)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-9-5-10(2)7-11(6-9)18-8-15-4-3-12(14-15)13(16)17/h3-7H,8H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | BJDDSMALJBAIRJ-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |