C19H23N3O4 — CID 19276327
ethyl (E)-3-[[1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate (PubChem CID 19276327) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl (E)-3-[[1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19276327 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | ethyl (E)-3-[[1-[(3,5-dimethylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1ccn(COc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C19H23N3O4/c1-5-25-18(23)11-15(4)20-19(24)17-6-7-22(21-17)12-26-16-9-13(2)8-14(3)10-16/h6-11H,5,12H2,1-4H3,(H,20,24)/b15-11+ |
| InChIKey | FBURXKQIFNXIPQ-RVDMUPIBSA-N |
| XLogP | 2.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|