C20H25N3O4 — CID 19276032
ethyl (E)-3-[[1-[(4-propan-2-ylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate (PubChem CID 19276032) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl (E)-3-[[1-[(4-propan-2-ylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[1-[(4-propan-2-ylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19276032 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | ethyl (E)-3-[[1-[(4-propan-2-ylphenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1ccn(COc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C20H25N3O4/c1-5-26-19(24)12-15(4)21-20(25)18-10-11-23(22-18)13-27-17-8-6-16(7-9-17)14(2)3/h6-12,14H,5,13H2,1-4H3,(H,21,25)/b15-12+ |
| InChIKey | YBOYOAANBCNFPB-NTCAYCPXSA-N |
| XLogP | 3.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|