C17H18BrN3O4 — CID 19272468
ethyl (E)-3-[[1-[(4-bromophenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate (PubChem CID 19272468) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is ethyl (E)-3-[[1-[(4-bromophenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[1-[(4-bromophenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19272468 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | ethyl (E)-3-[[1-[(4-bromophenoxy)methyl]pyrazole-3-carbonyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1ccn(COc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C17H18BrN3O4/c1-3-24-16(22)10-12(2)19-17(23)15-8-9-21(20-15)11-25-14-6-4-13(18)5-7-14/h4-10H,3,11H2,1-2H3,(H,19,23)/b12-10+ |
| InChIKey | FNOOHAOZJUZMEO-ZRDIBKRKSA-N |
| XLogP | 2.88 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|