C13H12BrN3S — CID 7017380
1-[(4-bromophenyl)methyl]-4-isothiocyanato-3,5-dimethylpyrazole (PubChem CID 7017380) has the molecular formula C13H12BrN3S and a molecular weight of 322.23 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-isothiocyanato-3,5-dimethylpyrazole.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-isothiocyanato-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 7017380 |
| Molecular Formula | C13H12BrN3S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-isothiocyanato-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cc2ccc(Br)cc2)c(C)c1N=C=S |
| InChI | InChI=1S/C13H12BrN3S/c1-9-13(15-8-18)10(2)17(16-9)7-11-3-5-12(14)6-4-11/h3-6H,7H2,1-2H3 |
| InChIKey | AOSTVPUKWNVMLT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|