C11H8ClN2O3- — CID 7017629
2-[(4-chlorophenoxy)methyl]pyrazole-3-carboxylate (PubChem CID 7017629) has the molecular formula C11H8ClN2O3- and a molecular weight of 251.65 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]pyrazole-3-carboxylate.
| Compound Name | 2-[(4-chlorophenoxy)methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7017629 |
| Molecular Formula | C11H8ClN2O3- |
| Molecular Weight | 251.65 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]pyrazole-3-carboxylate |
| SMILES | O=C([O-])c1ccnn1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClN2O3/c12-8-1-3-9(4-2-8)17-7-14-10(11(15)16)5-6-13-14/h1-6H,7H2,(H,15,16)/p-1 |
| InChIKey | GYKLRPNBQKOMDP-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.65 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |