C18H12ClN5O4 — CID 19507566
2-[(4-chlorophenoxy)methyl]-N-(2-cyano-4-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19507566) has the molecular formula C18H12ClN5O4 and a molecular weight of 397.78 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-N-(2-cyano-4-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-N-(2-cyano-4-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19507566 |
| Molecular Formula | C18H12ClN5O4 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-N-(2-cyano-4-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)c1ccnn1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12ClN5O4/c19-13-1-4-15(5-2-13)28-11-23-17(7-8-21-23)18(25)22-16-6-3-14(24(26)27)9-12(16)10-20/h1-9H,11H2,(H,22,25) |
| InChIKey | QKEHUZSXNOUATN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|