C20H26N4O3 — CID 70177013
(2S)-4-[(2-aminoacetyl)amino]pyrrolidine-2-carboxylic acid;(4-phenylphenyl)methanamine (PubChem CID 70177013) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2S)-4-[(2-aminoacetyl)amino]pyrrolidine-2-carboxylic acid;(4-phenylphenyl)methanamine.
| Compound Name | (2S)-4-[(2-aminoacetyl)amino]pyrrolidine-2-carboxylic acid;(4-phenylphenyl)methanamine |
|---|---|
| PubChem CID | 70177013 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2S)-4-[(2-aminoacetyl)amino]pyrrolidine-2-carboxylic acid;(4-phenylphenyl)methanamine |
| SMILES | NCC(=O)NC1CN[C@H](C(=O)O)C1.NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H13N.C7H13N3O3/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;8-2-6(11)10-4-1-5(7(12)13)9-3-4/h1-9H,10,14H2;4-5,9H,1-3,8H2,(H,10,11)(H,12,13)/t;4?,5-/m.0/s1 |
| InChIKey | ANEMXIKDOWNPHA-IMPWDBNVSA-N |
| XLogP | 0.69 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |