C25H30NO3P — CID 70179153
N-bis(2-ethylphenoxy)phosphoryl-4-propylaniline (PubChem CID 70179153) has the molecular formula C25H30NO3P and a molecular weight of 423.49 g/mol. Its IUPAC name is N-bis(2-ethylphenoxy)phosphoryl-4-propylaniline.
| Compound Name | N-bis(2-ethylphenoxy)phosphoryl-4-propylaniline |
|---|---|
| PubChem CID | 70179153 |
| Molecular Formula | C25H30NO3P |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-bis(2-ethylphenoxy)phosphoryl-4-propylaniline |
| SMILES | CCCc1ccc(NP(=O)(Oc2ccccc2CC)Oc2ccccc2CC)cc1 |
| InChI | InChI=1S/C25H30NO3P/c1-4-11-20-16-18-23(19-17-20)26-30(27,28-24-14-9-7-12-21(24)5-2)29-25-15-10-8-13-22(25)6-3/h7-10,12-19H,4-6,11H2,1-3H3,(H,26,27) |
| InChIKey | NMCKTZXHZVJKTQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|