C17H21O2PS2 — CID 88667793
(4-ethylphenoxy)-(2-propylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88667793) has the molecular formula C17H21O2PS2 and a molecular weight of 352.46 g/mol. Its IUPAC name is (4-ethylphenoxy)-(2-propylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | (4-ethylphenoxy)-(2-propylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 88667793 |
| Molecular Formula | C17H21O2PS2 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (4-ethylphenoxy)-(2-propylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCc1ccccc1OP(=S)(S)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C17H21O2PS2/c1-3-7-15-8-5-6-9-17(15)19-20(21,22)18-16-12-10-14(4-2)11-13-16/h5-6,8-13H,3-4,7H2,1-2H3,(H,21,22) |
| InChIKey | TXUIIWQGMZOHLA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|