About bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol
bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol (PubChem CID 162747363) has the molecular formula C17H23O3PS2
and a molecular weight of 370.48 g/mol. Its IUPAC name is bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol.
Molecular Properties
| Compound Name | bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol |
| PubChem CID | 162747363 |
| Molecular Formula | C17H23O3PS2 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol |
| SMILES | CCc1ccc(OP(=S)(S)Oc2ccc(CC)cc2)cc1.CO |
| InChI | InChI=1S/C16H19O2PS2.CH4O/c1-3-13-5-9-15(10-6-13)17-19(20,21)18-16-11-7-14(4-2)8-12-16;1-2/h5-12H,3-4H2,1-2H3,(H,20,21);2H,1H3 |
| InChIKey | CIZVNZJLGARPNE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol?
The IUPAC name of bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol (CID 162747363) is bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol.
What is the SMILES notation for bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol?
The canonical SMILES for bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol is CCc1ccc(OP(=S)(S)Oc2ccc(CC)cc2)cc1.CO.
What is the InChIKey of bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol?
The InChIKey is CIZVNZJLGARPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19O2PS2.CH4O/c1-3-13-5-9-15(10-6-13)17-19(20,21)18-16-11-7-14(4-2)8-12-16;1-2/h5-12H,3-4H2,1-2H3,(H,20,21);2H,1H3.
What are the key properties of bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol?
bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol has a molecular weight of 370.48 g/mol, XLogP of 5.03, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethylphenoxy)-sulfanyl-sulfanylidene-λ5-phosphane;methanol is sourced from PubChem (CID 162747363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).