C17H22NO2P — CID 11860169
4-ethyl-N-[(4-ethylphenoxy)-methylphosphoryl]aniline (PubChem CID 11860169) has the molecular formula C17H22NO2P and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-ethyl-N-[(4-ethylphenoxy)-methylphosphoryl]aniline.
| Compound Name | 4-ethyl-N-[(4-ethylphenoxy)-methylphosphoryl]aniline |
|---|---|
| PubChem CID | 11860169 |
| Molecular Formula | C17H22NO2P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-ethyl-N-[(4-ethylphenoxy)-methylphosphoryl]aniline |
| SMILES | CCc1ccc(N[P@@](C)(=O)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C17H22NO2P/c1-4-14-6-10-16(11-7-14)18-21(3,19)20-17-12-8-15(5-2)9-13-17/h6-13H,4-5H2,1-3H3,(H,18,19)/t21-/m0/s1 |
| InChIKey | WBPQGHNPOWQAQH-NRFANRHFSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|