C15H16Cl2NO2P — CID 11860108
2,5-dichloro-N-[(4-ethylphenoxy)-methylphosphoryl]aniline (PubChem CID 11860108) has the molecular formula C15H16Cl2NO2P and a molecular weight of 344.18 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4-ethylphenoxy)-methylphosphoryl]aniline.
| Compound Name | 2,5-dichloro-N-[(4-ethylphenoxy)-methylphosphoryl]aniline |
|---|---|
| PubChem CID | 11860108 |
| Molecular Formula | C15H16Cl2NO2P |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2,5-dichloro-N-[(4-ethylphenoxy)-methylphosphoryl]aniline |
| SMILES | CCc1ccc(O[P@@](C)(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H16Cl2NO2P/c1-3-11-4-7-13(8-5-11)20-21(2,19)18-15-10-12(16)6-9-14(15)17/h4-10H,3H2,1-2H3,(H,18,19)/t21-/m1/s1 |
| InChIKey | BSZIPTIGHMTQDK-OAQYLSRUSA-N |
| XLogP | 5.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|