C14H13Cl3NO2P — CID 3352310
2,5-dichloro-N-[(2-chloro-5-methylphenoxy)-methylphosphoryl]aniline (PubChem CID 3352310) has the molecular formula C14H13Cl3NO2P and a molecular weight of 364.60 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2-chloro-5-methylphenoxy)-methylphosphoryl]aniline.
| Compound Name | 2,5-dichloro-N-[(2-chloro-5-methylphenoxy)-methylphosphoryl]aniline |
|---|---|
| PubChem CID | 3352310 |
| Molecular Formula | C14H13Cl3NO2P |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2,5-dichloro-N-[(2-chloro-5-methylphenoxy)-methylphosphoryl]aniline |
| SMILES | Cc1ccc(Cl)c(OP(C)(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H13Cl3NO2P/c1-9-3-5-12(17)14(7-9)20-21(2,19)18-13-8-10(15)4-6-11(13)16/h3-8H,1-2H3,(H,18,19) |
| InChIKey | PRIZEVYZSGJATN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|