C14H12FN3O2 — CID 70179694
methyl 3-(4-cyano-3-fluorophenyl)-2-(1H-imidazol-5-yl)propanoate (PubChem CID 70179694) has the molecular formula C14H12FN3O2 and a molecular weight of 273.27 g/mol. Its IUPAC name is methyl 3-(4-cyano-3-fluorophenyl)-2-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl 3-(4-cyano-3-fluorophenyl)-2-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 70179694 |
| Molecular Formula | C14H12FN3O2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | methyl 3-(4-cyano-3-fluorophenyl)-2-(1H-imidazol-5-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(C#N)c(F)c1)c1cnc[nH]1 |
| InChI | InChI=1S/C14H12FN3O2/c1-20-14(19)11(13-7-17-8-18-13)4-9-2-3-10(6-16)12(15)5-9/h2-3,5,7-8,11H,4H2,1H3,(H,17,18) |
| InChIKey | JIVYJJXJAYCZBI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |