About 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate
3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate (PubChem CID 10809147) has the molecular formula C14H15IN2O2
and a molecular weight of 370.19 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate |
| PubChem CID | 10809147 |
| Molecular Formula | C14H15IN2O2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate |
| SMILES | O=C(Cc1ccc(I)cc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H15IN2O2/c15-12-5-3-11(4-6-12)8-14(18)19-7-1-2-13-9-16-10-17-13/h3-6,9-10H,1-2,7-8H2,(H,16,17) |
| InChIKey | AVMKSITYPIVSLI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate?
The IUPAC name of 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate (CID 10809147) is 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate.
What is the SMILES notation for 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate?
The canonical SMILES for 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate is O=C(Cc1ccc(I)cc1)OCCCc1cnc[nH]1.
What is the InChIKey of 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate?
The InChIKey is AVMKSITYPIVSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15IN2O2/c15-12-5-3-11(4-6-12)8-14(18)19-7-1-2-13-9-16-10-17-13/h3-6,9-10H,1-2,7-8H2,(H,16,17).
What are the key properties of 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate?
3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate has a molecular weight of 370.19 g/mol, XLogP of 2.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)propyl 2-(4-iodophenyl)acetate is sourced from PubChem (CID 10809147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).