C14H15N3O3 — CID 10802210
3-(1H-imidazol-5-yl)propyl N-benzoylcarbamate (PubChem CID 10802210) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-benzoylcarbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-benzoylcarbamate |
|---|---|
| PubChem CID | 10802210 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-benzoylcarbamate |
| SMILES | O=C(NC(=O)c1ccccc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H15N3O3/c18-13(11-5-2-1-3-6-11)17-14(19)20-8-4-7-12-9-15-10-16-12/h1-3,5-6,9-10H,4,7-8H2,(H,15,16)(H,17,18,19) |
| InChIKey | VDGPAEGNHHHBSY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|