C14H14F3N3O2 — CID 10358195
3-(1H-imidazol-5-yl)propyl N-[4-(trifluoromethyl)phenyl]carbamate (PubChem CID 10358195) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-[4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-[4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 10358195 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-[4-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H14F3N3O2/c15-14(16,17)10-3-5-11(6-4-10)20-13(21)22-7-1-2-12-8-18-9-19-12/h3-6,8-9H,1-2,7H2,(H,18,19)(H,20,21) |
| InChIKey | VVGXIYVZJGKQDO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|