C14H18N4O2 — CID 10731042
3-(1H-imidazol-5-yl)propyl N-[(4-aminophenyl)methyl]carbamate (PubChem CID 10731042) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-[(4-aminophenyl)methyl]carbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-[(4-aminophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 10731042 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-[(4-aminophenyl)methyl]carbamate |
| SMILES | Nc1ccc(CNC(=O)OCCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C14H18N4O2/c15-12-5-3-11(4-6-12)8-17-14(19)20-7-1-2-13-9-16-10-18-13/h3-6,9-10H,1-2,7-8,15H2,(H,16,18)(H,17,19) |
| InChIKey | YLWSHUHEOAKOBV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|