C12H19ClN2O4S — CID 70180065
2-amino-3-[4-(methanesulfonamido)phenyl]pentanoic acid;hydrochloride (PubChem CID 70180065) has the molecular formula C12H19ClN2O4S and a molecular weight of 322.81 g/mol. Its IUPAC name is 2-amino-3-[4-(methanesulfonamido)phenyl]pentanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[4-(methanesulfonamido)phenyl]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70180065 |
| Molecular Formula | C12H19ClN2O4S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-amino-3-[4-(methanesulfonamido)phenyl]pentanoic acid;hydrochloride |
| SMILES | CCC(c1ccc(NS(C)(=O)=O)cc1)C(N)C(=O)O.Cl |
| InChI | InChI=1S/C12H18N2O4S.ClH/c1-3-10(11(13)12(15)16)8-4-6-9(7-5-8)14-19(2,17)18;/h4-7,10-11,14H,3,13H2,1-2H3,(H,15,16);1H |
| InChIKey | KGKTVJUNSFANAH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |