C23H37NO3 — CID 70182643
1-[(8R,9S,10R,13S,14S,17R)-3-(1-aminoethoxy)-17-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 70182643) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is 1-[(8R,9S,10R,13S,14S,17R)-3-(1-aminoethoxy)-17-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8R,9S,10R,13S,14S,17R)-3-(1-aminoethoxy)-17-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 70182643 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | 1-[(8R,9S,10R,13S,14S,17R)-3-(1-aminoethoxy)-17-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(OC(C)N)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H37NO3/c1-14(25)23(26)12-9-20-18-6-5-16-13-17(27-15(2)24)7-10-21(16,3)19(18)8-11-22(20,23)4/h13,15,17-20,26H,5-12,24H2,1-4H3/t15?,17?,18-,19+,20+,21+,22+,23+/m1/s1 |
| InChIKey | ATFPWZOEIVAXSG-VUIDFXAKSA-N |
| XLogP | 3.96 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|