C10H13NO5 — CID 70182858
2-(1,2,4-trihydroxybutan-2-yl)pyridine-3-carboxylic acid (PubChem CID 70182858) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-(1,2,4-trihydroxybutan-2-yl)pyridine-3-carboxylic acid.
| Compound Name | 2-(1,2,4-trihydroxybutan-2-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70182858 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(1,2,4-trihydroxybutan-2-yl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1C(O)(CO)CCO |
| InChI | InChI=1S/C10H13NO5/c12-5-3-10(16,6-13)8-7(9(14)15)2-1-4-11-8/h1-2,4,12-13,16H,3,5-6H2,(H,14,15) |
| InChIKey | UYQDAXKAJTZOKS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |