C29H45NOSi — CID 70183841
3-[dimethyl(nonyl)silyl]-N-[2-(4-methylphenyl)-2-phenylethyl]propanamide (PubChem CID 70183841) has the molecular formula C29H45NOSi and a molecular weight of 451.77 g/mol. Its IUPAC name is 3-[dimethyl(nonyl)silyl]-N-[2-(4-methylphenyl)-2-phenylethyl]propanamide.
| Compound Name | 3-[dimethyl(nonyl)silyl]-N-[2-(4-methylphenyl)-2-phenylethyl]propanamide |
|---|---|
| PubChem CID | 70183841 |
| Molecular Formula | C29H45NOSi |
| Molecular Weight | 451.77 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | 3-[dimethyl(nonyl)silyl]-N-[2-(4-methylphenyl)-2-phenylethyl]propanamide |
| SMILES | CCCCCCCCC[Si](C)(C)CCC(=O)NCC(c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H45NOSi/c1-5-6-7-8-9-10-14-22-32(3,4)23-21-29(31)30-24-28(26-15-12-11-13-16-26)27-19-17-25(2)18-20-27/h11-13,15-20,28H,5-10,14,21-24H2,1-4H3,(H,30,31) |
| InChIKey | WJEZITFZDVIURJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.77 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|